C30H48AcO2 — CID 20767068
actinium;2,5,7,8-tetramethyl-2-[(E)-4,6,8,12-tetramethyltridec-3-enyl]chromen-6-ol (PubChem CID 20767068) has the molecular formula C30H48AcO2 and a molecular weight of 667.71 g/mol. Its IUPAC name is actinium;2,5,7,8-tetramethyl-2-[(E)-4,6,8,12-tetramethyltridec-3-enyl]chromen-6-ol.
| Compound Name | actinium;2,5,7,8-tetramethyl-2-[(E)-4,6,8,12-tetramethyltridec-3-enyl]chromen-6-ol |
|---|---|
| PubChem CID | 20767068 |
| Molecular Formula | C30H48AcO2 |
| Molecular Weight | 667.71 g/mol |
| Exact Mass | 667.39 |
| IUPAC Name | actinium;2,5,7,8-tetramethyl-2-[(E)-4,6,8,12-tetramethyltridec-3-enyl]chromen-6-ol |
| SMILES | C/C(=C\CCC1(C)C=Cc2c(C)c(O)c(C)c(C)c2O1)CC(C)CC(C)CCCC(C)C.[Ac] |
| InChI | InChI=1S/C30H48O2.Ac/c1-20(2)12-10-13-21(3)18-23(5)19-22(4)14-11-16-30(9)17-15-27-26(8)28(31)24(6)25(7)29(27)32-30;/h14-15,17,20-21,23,31H,10-13,16,18-19H2,1-9H3;/b22-14+; |
| InChIKey | YZLSYJXQXUURSL-CWUUNJJBSA-N |
| XLogP | 9.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.71 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|