C29H50O2 — CID 12018728
2,3,4,6,7-pentamethyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-ol (PubChem CID 12018728) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is 2,3,4,6,7-pentamethyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-ol.
| Compound Name | 2,3,4,6,7-pentamethyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 12018728 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | 2,3,4,6,7-pentamethyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)C(C)C(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C29H50O2/c1-19(2)13-10-14-20(3)15-11-16-21(4)17-12-18-29(9)25(8)26-24(7)27(30)22(5)23(6)28(26)31-29/h19-21,25,30H,10-18H2,1-9H3 |
| InChIKey | PMIMOLIQGNWOJE-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |