C27H44O2 — CID 102106996
2,8-dimethyl-2-(2,8,12-trimethyltridecyl)chromen-6-ol (PubChem CID 102106996) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is 2,8-dimethyl-2-(2,8,12-trimethyltridecyl)chromen-6-ol.
| Compound Name | 2,8-dimethyl-2-(2,8,12-trimethyltridecyl)chromen-6-ol |
|---|---|
| PubChem CID | 102106996 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 2,8-dimethyl-2-(2,8,12-trimethyltridecyl)chromen-6-ol |
| SMILES | Cc1cc(O)cc2c1OC(C)(CC(C)CCCCCC(C)CCCC(C)C)C=C2 |
| InChI | InChI=1S/C27H44O2/c1-20(2)11-10-14-21(3)12-8-7-9-13-22(4)19-27(6)16-15-24-18-25(28)17-23(5)26(24)29-27/h15-18,20-22,28H,7-14,19H2,1-6H3 |
| InChIKey | WRPXDAKUTWXTLC-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|