C27H48O2 — CID 167473790
2,8-dimethyl-3,4-dihydro-2H-chromen-6-ol;2,6,10-trimethyltridecane (PubChem CID 167473790) has the molecular formula C27H48O2 and a molecular weight of 404.68 g/mol. Its IUPAC name is 2,8-dimethyl-3,4-dihydro-2H-chromen-6-ol;2,6,10-trimethyltridecane.
| Compound Name | 2,8-dimethyl-3,4-dihydro-2H-chromen-6-ol;2,6,10-trimethyltridecane |
|---|---|
| PubChem CID | 167473790 |
| Molecular Formula | C27H48O2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.37 |
| IUPAC Name | 2,8-dimethyl-3,4-dihydro-2H-chromen-6-ol;2,6,10-trimethyltridecane |
| SMILES | CCCC(C)CCCC(C)CCCC(C)C.Cc1cc(O)cc2c1OC(C)CC2 |
| InChI | InChI=1S/C16H34.C11H14O2/c1-6-9-15(4)12-8-13-16(5)11-7-10-14(2)3;1-7-5-10(12)6-9-4-3-8(2)13-11(7)9/h14-16H,6-13H2,1-5H3;5-6,8,12H,3-4H2,1-2H3 |
| InChIKey | ATCBEXKFPRYOOU-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |