C27H46O2 — CID 156640168
(2R)-2-[(4R)-4,12-dimethyltridecyl]-5,7,8-trimethyl-3,4-dihydro-2H-chromen-6-ol (PubChem CID 156640168) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is (2R)-2-[(4R)-4,12-dimethyltridecyl]-5,7,8-trimethyl-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | (2R)-2-[(4R)-4,12-dimethyltridecyl]-5,7,8-trimethyl-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 156640168 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | (2R)-2-[(4R)-4,12-dimethyltridecyl]-5,7,8-trimethyl-3,4-dihydro-2H-chromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CC[C@@H](CCC[C@H](C)CCCCCCCC(C)C)O2 |
| InChI | InChI=1S/C27H46O2/c1-19(2)13-10-8-7-9-11-14-20(3)15-12-16-24-17-18-25-23(6)26(28)21(4)22(5)27(25)29-24/h19-20,24,28H,7-18H2,1-6H3/t20-,24-/m1/s1 |
| InChIKey | LSHDTSKHTLPGNT-HYBUGGRVSA-N |
| XLogP | 8.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|