C27H26O4 — CID 171343287
(E)-3-(1-benzofuran-5-yl)-1-[7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]prop-2-en-1-one (PubChem CID 171343287) has the molecular formula C27H26O4 and a molecular weight of 414.50 g/mol. Its IUPAC name is (E)-3-(1-benzofuran-5-yl)-1-[7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1-benzofuran-5-yl)-1-[7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171343287 |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (E)-3-(1-benzofuran-5-yl)-1-[7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]prop-2-en-1-one |
| SMILES | CC(C)=CCCC1(C)C=Cc2ccc(O)c(C(=O)/C=C/c3ccc4occc4c3)c2O1 |
| InChI | InChI=1S/C27H26O4/c1-18(2)5-4-14-27(3)15-12-20-8-10-23(29)25(26(20)31-27)22(28)9-6-19-7-11-24-21(17-19)13-16-30-24/h5-13,15-17,29H,4,14H2,1-3H3/b9-6+ |
| InChIKey | QVEFLBBSTAZSMY-RMKNXTFCSA-N |
| XLogP | 6.95 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|