C20H25HoO3- — CID 156732157
holmium;2-methyl-2-(4-methylpent-3-enyl)-7-propyl-5H-chromen-5-ide-8-carboxylic acid (PubChem CID 156732157) has the molecular formula C20H25HoO3- and a molecular weight of 478.35 g/mol. Its IUPAC name is holmium;2-methyl-2-(4-methylpent-3-enyl)-7-propyl-5H-chromen-5-ide-8-carboxylic acid.
| Compound Name | holmium;2-methyl-2-(4-methylpent-3-enyl)-7-propyl-5H-chromen-5-ide-8-carboxylic acid |
|---|---|
| PubChem CID | 156732157 |
| Molecular Formula | C20H25HoO3- |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | holmium;2-methyl-2-(4-methylpent-3-enyl)-7-propyl-5H-chromen-5-ide-8-carboxylic acid |
| SMILES | CCCc1c[c-]c2c(c1C(=O)O)OC(C)(CCC=C(C)C)C=C2.[Ho] |
| InChI | InChI=1S/C20H25O3.Ho/c1-5-7-15-9-10-16-11-13-20(4,12-6-8-14(2)3)23-18(16)17(15)19(21)22;/h8-9,11,13H,5-7,12H2,1-4H3,(H,21,22);/q-1; |
| InChIKey | JBRUCJYCFLUZGY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|