C24H24O6 — CID 163010206
5,7-dihydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-6-(2-methylpropanoyl)-4-phenylchromen-2-one (PubChem CID 163010206) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is 5,7-dihydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-6-(2-methylpropanoyl)-4-phenylchromen-2-one.
| Compound Name | 5,7-dihydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-6-(2-methylpropanoyl)-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 163010206 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 5,7-dihydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-6-(2-methylpropanoyl)-4-phenylchromen-2-one |
| SMILES | C=C(C)[C@H](O)Cc1c(O)c(C(=O)C(C)C)c(O)c2c(-c3ccccc3)cc(=O)oc12 |
| InChI | InChI=1S/C24H24O6/c1-12(2)17(25)10-16-22(28)20(21(27)13(3)4)23(29)19-15(11-18(26)30-24(16)19)14-8-6-5-7-9-14/h5-9,11,13,17,25,28-29H,1,10H2,2-4H3/t17-/m1/s1 |
| InChIKey | HUJQDILIRUAUFY-QGZVFWFLSA-N |
| XLogP | 4.19 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|