C25H24O7 — CID 162901736
(12R,16S)-8-hydroxy-13,13-dimethyl-9-[(2S)-2-methylbutanoyl]-6-phenyl-3,11,14,15-tetraoxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraen-4-one (PubChem CID 162901736) has the molecular formula C25H24O7 and a molecular weight of 436.46 g/mol. Its IUPAC name is (12R,16S)-8-hydroxy-13,13-dimethyl-9-[(2S)-2-methylbutanoyl]-6-phenyl-3,11,14,15-tetraoxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraen-4-one.
| Compound Name | (12R,16S)-8-hydroxy-13,13-dimethyl-9-[(2S)-2-methylbutanoyl]-6-phenyl-3,11,14,15-tetraoxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraen-4-one |
|---|---|
| PubChem CID | 162901736 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (12R,16S)-8-hydroxy-13,13-dimethyl-9-[(2S)-2-methylbutanoyl]-6-phenyl-3,11,14,15-tetraoxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraen-4-one |
| SMILES | CC[C@H](C)C(=O)c1c2c(c3oc(=O)cc(-c4ccccc4)c3c1O)[C@@H]1OOC(C)(C)[C@@H]1O2 |
| InChI | InChI=1S/C25H24O7/c1-5-12(2)19(27)17-20(28)16-14(13-9-7-6-8-10-13)11-15(26)29-21(16)18-22(17)30-24-23(18)31-32-25(24,3)4/h6-12,23-24,28H,5H2,1-4H3/t12-,23-,24+/m0/s1 |
| InChIKey | SQBZDGYHAWUFPT-PHVSPZQESA-N |
| XLogP | 4.94 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|