C26H28O6 — CID 163039467
5-hydroxy-8-(2-hydroxypropan-2-yl)-6-(4-methylpentanoyl)-4-phenyl-8,9-dihydrofuro[2,3-h]chromen-2-one (PubChem CID 163039467) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is 5-hydroxy-8-(2-hydroxypropan-2-yl)-6-(4-methylpentanoyl)-4-phenyl-8,9-dihydrofuro[2,3-h]chromen-2-one.
| Compound Name | 5-hydroxy-8-(2-hydroxypropan-2-yl)-6-(4-methylpentanoyl)-4-phenyl-8,9-dihydrofuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 163039467 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 5-hydroxy-8-(2-hydroxypropan-2-yl)-6-(4-methylpentanoyl)-4-phenyl-8,9-dihydrofuro[2,3-h]chromen-2-one |
| SMILES | CC(C)CCC(=O)c1c2c(c3oc(=O)cc(-c4ccccc4)c3c1O)CC(C(C)(C)O)O2 |
| InChI | InChI=1S/C26H28O6/c1-14(2)10-11-18(27)22-23(29)21-16(15-8-6-5-7-9-15)13-20(28)32-24(21)17-12-19(26(3,4)30)31-25(17)22/h5-9,13-14,19,29-30H,10-12H2,1-4H3 |
| InChIKey | DEHDFYPILQMQOD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|