C20H16O9S — CID 131833780
(3,5-dihydroxy-8-methyl-4-oxo-2-phenylpyrano[2,3-h]chromen-8-yl)methyl hydrogen sulfate (PubChem CID 131833780) has the molecular formula C20H16O9S and a molecular weight of 432.41 g/mol. Its IUPAC name is (3,5-dihydroxy-8-methyl-4-oxo-2-phenylpyrano[2,3-h]chromen-8-yl)methyl hydrogen sulfate.
| Compound Name | (3,5-dihydroxy-8-methyl-4-oxo-2-phenylpyrano[2,3-h]chromen-8-yl)methyl hydrogen sulfate |
|---|---|
| PubChem CID | 131833780 |
| Molecular Formula | C20H16O9S |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | (3,5-dihydroxy-8-methyl-4-oxo-2-phenylpyrano[2,3-h]chromen-8-yl)methyl hydrogen sulfate |
| SMILES | CC1(COS(=O)(=O)O)C=Cc2c(cc(O)c3c(=O)c(O)c(-c4ccccc4)oc23)O1 |
| InChI | InChI=1S/C20H16O9S/c1-20(10-27-30(24,25)26)8-7-12-14(29-20)9-13(21)15-16(22)17(23)18(28-19(12)15)11-5-3-2-4-6-11/h2-9,21,23H,10H2,1H3,(H,24,25,26) |
| InChIKey | FPVMMMZRDOSNKR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|