C20H18O5 — CID 54466070
3,5,6-trihydroxy-8-(3-methylbut-2-enyl)-2-phenylchromen-4-one (PubChem CID 54466070) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 3,5,6-trihydroxy-8-(3-methylbut-2-enyl)-2-phenylchromen-4-one.
| Compound Name | 3,5,6-trihydroxy-8-(3-methylbut-2-enyl)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 54466070 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3,5,6-trihydroxy-8-(3-methylbut-2-enyl)-2-phenylchromen-4-one |
| SMILES | CC(C)=CCc1cc(O)c(O)c2c(=O)c(O)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C20H18O5/c1-11(2)8-9-13-10-14(21)16(22)15-17(23)18(24)20(25-19(13)15)12-6-4-3-5-7-12/h3-8,10,21-22,24H,9H2,1-2H3 |
| InChIKey | XEYGLCNJUDSWFZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|