C13H7Cl2NO — CID 138629142
3,4-dichloro-10H-acridin-9-one (PubChem CID 138629142) has the molecular formula C13H7Cl2NO and a molecular weight of 264.11 g/mol. Its IUPAC name is 3,4-dichloro-10H-acridin-9-one.
| Compound Name | 3,4-dichloro-10H-acridin-9-one |
|---|---|
| PubChem CID | 138629142 |
| Molecular Formula | C13H7Cl2NO |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 3,4-dichloro-10H-acridin-9-one |
| SMILES | O=c1c2ccccc2[nH]c2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C13H7Cl2NO/c14-9-6-5-8-12(11(9)15)16-10-4-2-1-3-7(10)13(8)17/h1-6H,(H,16,17) |
| InChIKey | IIJDNCAHEDVUNR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|