C16H10N2O2 — CID 51038700
6,13-diazatetracyclo[12.4.0.02,5.07,12]octadeca-1(18),2(5),7,9,11,14,16-heptaene-3,4-dione (PubChem CID 51038700) has the molecular formula C16H10N2O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 6,13-diazatetracyclo[12.4.0.02,5.07,12]octadeca-1(18),2(5),7,9,11,14,16-heptaene-3,4-dione.
| Compound Name | 6,13-diazatetracyclo[12.4.0.02,5.07,12]octadeca-1(18),2(5),7,9,11,14,16-heptaene-3,4-dione |
|---|---|
| PubChem CID | 51038700 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 6,13-diazatetracyclo[12.4.0.02,5.07,12]octadeca-1(18),2(5),7,9,11,14,16-heptaene-3,4-dione |
| SMILES | O=c1c(=O)c2c1[nH]c1ccccc1[nH]c1ccccc12 |
| InChI | InChI=1S/C16H10N2O2/c19-15-13-9-5-1-2-6-10(9)17-11-7-3-4-8-12(11)18-14(13)16(15)20/h1-8,17-18H |
| InChIKey | RXGOCGKHDWPIRA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|