C12H5Br4N — CID 70631482
1,2,3,4-tetrabromo-9H-carbazole (PubChem CID 70631482) has the molecular formula C12H5Br4N and a molecular weight of 482.80 g/mol. Its IUPAC name is 1,2,3,4-tetrabromo-9H-carbazole.
| Compound Name | 1,2,3,4-tetrabromo-9H-carbazole |
|---|---|
| PubChem CID | 70631482 |
| Molecular Formula | C12H5Br4N |
| Molecular Weight | 482.80 g/mol |
| Exact Mass | 478.72 |
| IUPAC Name | 1,2,3,4-tetrabromo-9H-carbazole |
| SMILES | Brc1c(Br)c(Br)c2c([nH]c3ccccc32)c1Br |
| InChI | InChI=1S/C12H5Br4N/c13-8-7-5-3-1-2-4-6(5)17-12(7)11(16)10(15)9(8)14/h1-4,17H |
| InChIKey | JXQITLOHBIYZNO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.80 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|