C14H12O6 — CID 135563709
3,6,7,9-tetrahydroxy-3-methyl-2H-benzo[f]chromen-1-one (PubChem CID 135563709) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is 3,6,7,9-tetrahydroxy-3-methyl-2H-benzo[f]chromen-1-one.
| Compound Name | 3,6,7,9-tetrahydroxy-3-methyl-2H-benzo[f]chromen-1-one |
|---|---|
| PubChem CID | 135563709 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3,6,7,9-tetrahydroxy-3-methyl-2H-benzo[f]chromen-1-one |
| SMILES | CC1(O)CC(=O)c2c(cc(O)c3c(O)cc(O)cc23)O1 |
| InChI | InChI=1S/C14H12O6/c1-14(19)5-10(18)13-7-2-6(15)3-8(16)12(7)9(17)4-11(13)20-14/h2-4,15-17,19H,5H2,1H3 |
| InChIKey | XHAKGHGCOBKEEK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |