C10H10O6 — CID 162878849
(3R,4S)-3,4,6,8-tetrahydroxy-3-methyl-4H-isochromen-1-one (PubChem CID 162878849) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is (3R,4S)-3,4,6,8-tetrahydroxy-3-methyl-4H-isochromen-1-one.
| Compound Name | (3R,4S)-3,4,6,8-tetrahydroxy-3-methyl-4H-isochromen-1-one |
|---|---|
| PubChem CID | 162878849 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (3R,4S)-3,4,6,8-tetrahydroxy-3-methyl-4H-isochromen-1-one |
| SMILES | C[C@@]1(O)OC(=O)c2c(O)cc(O)cc2[C@@H]1O |
| InChI | InChI=1S/C10H10O6/c1-10(15)8(13)5-2-4(11)3-6(12)7(5)9(14)16-10/h2-3,8,11-13,15H,1H3/t8-,10+/m0/s1 |
| InChIKey | GQRRJOCFFMMORD-WCBMZHEXSA-N |
| XLogP | 0.01 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |