C16H16O9 — CID 139585152
(11R,12S,13S,14S)-4,11,12,13,14-pentahydroxy-6-methoxy-12-methyl-15-oxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-triene-2,9-dione (PubChem CID 139585152) has the molecular formula C16H16O9 and a molecular weight of 352.30 g/mol. Its IUPAC name is (11R,12S,13S,14S)-4,11,12,13,14-pentahydroxy-6-methoxy-12-methyl-15-oxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-triene-2,9-dione.
| Compound Name | (11R,12S,13S,14S)-4,11,12,13,14-pentahydroxy-6-methoxy-12-methyl-15-oxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-triene-2,9-dione |
|---|---|
| PubChem CID | 139585152 |
| Molecular Formula | C16H16O9 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (11R,12S,13S,14S)-4,11,12,13,14-pentahydroxy-6-methoxy-12-methyl-15-oxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-triene-2,9-dione |
| SMILES | COc1cc(O)c2c(c1)C(=O)C13OC1(C2=O)C(O)[C@H](O)[C@](C)(O)C3O |
| InChI | InChI=1S/C16H16O9/c1-14(23)11(20)12(21)15-10(19)8-6(3-5(24-2)4-7(8)17)9(18)16(15,25-15)13(14)22/h3-4,11-13,17,20-23H,1-2H3/t11-,12?,13?,14-,15?,16?/m0/s1 |
| InChIKey | IGQRNPSFVHAGKN-JTMMYVGMSA-N |
| XLogP | -1.87 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|