C19H21NO7 — CID 162897373
2-(7-hydroxy-5-methoxy-2,9-dioxo-11-propyl-12,15-dioxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-trien-13-yl)acetamide (PubChem CID 162897373) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-(7-hydroxy-5-methoxy-2,9-dioxo-11-propyl-12,15-dioxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-trien-13-yl)acetamide.
| Compound Name | 2-(7-hydroxy-5-methoxy-2,9-dioxo-11-propyl-12,15-dioxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-trien-13-yl)acetamide |
|---|---|
| PubChem CID | 162897373 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-(7-hydroxy-5-methoxy-2,9-dioxo-11-propyl-12,15-dioxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-trien-13-yl)acetamide |
| SMILES | CCCC1OC(CC(N)=O)CC23OC12C(=O)c1c(O)cc(OC)cc1C3=O |
| InChI | InChI=1S/C19H21NO7/c1-3-4-13-19-17(24)15-11(5-9(25-2)6-12(15)21)16(23)18(19,27-19)8-10(26-13)7-14(20)22/h5-6,10,13,21H,3-4,7-8H2,1-2H3,(H2,20,22) |
| InChIKey | BVHMHHVRJIFURL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|