C18H16O7 — CID 85057577
4-hydroxy-17-propyl-12,16,18-trioxapentacyclo[8.7.1.01,10.03,8.011,15]octadeca-3(8),4,6-triene-2,9,13-trione (PubChem CID 85057577) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 4-hydroxy-17-propyl-12,16,18-trioxapentacyclo[8.7.1.01,10.03,8.011,15]octadeca-3(8),4,6-triene-2,9,13-trione.
| Compound Name | 4-hydroxy-17-propyl-12,16,18-trioxapentacyclo[8.7.1.01,10.03,8.011,15]octadeca-3(8),4,6-triene-2,9,13-trione |
|---|---|
| PubChem CID | 85057577 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-hydroxy-17-propyl-12,16,18-trioxapentacyclo[8.7.1.01,10.03,8.011,15]octadeca-3(8),4,6-triene-2,9,13-trione |
| SMILES | CCCC1OC2CC(=O)OC2C23OC12C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C18H16O7/c1-2-4-11-17-15(22)13-8(5-3-6-9(13)19)14(21)18(17,25-17)16-10(23-11)7-12(20)24-16/h3,5-6,10-11,16,19H,2,4,7H2,1H3 |
| InChIKey | ZWOJCPOIYCQLQX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|