C16H18O7 — CID 162812848
(1R,3S,4aR,10aR)-4a,9,10a-trihydroxy-3-(2-hydroxyethyl)-1-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione (PubChem CID 162812848) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is (1R,3S,4aR,10aR)-4a,9,10a-trihydroxy-3-(2-hydroxyethyl)-1-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione.
| Compound Name | (1R,3S,4aR,10aR)-4a,9,10a-trihydroxy-3-(2-hydroxyethyl)-1-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
|---|---|
| PubChem CID | 162812848 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (1R,3S,4aR,10aR)-4a,9,10a-trihydroxy-3-(2-hydroxyethyl)-1-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| SMILES | C[C@H]1O[C@@H](CCO)C[C@]2(O)C(=O)c3cccc(O)c3C(=O)[C@@]12O |
| InChI | InChI=1S/C16H18O7/c1-8-16(22)14(20)12-10(3-2-4-11(12)18)13(19)15(16,21)7-9(23-8)5-6-17/h2-4,8-9,17-18,21-22H,5-7H2,1H3/t8-,9+,15+,16+/m1/s1 |
| InChIKey | SPSVXKCRZBHPJN-CQBFRLIXSA-N |
| XLogP | -0.21 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|