C16H16O7 — CID 53483701
(1S,2R,10R,11S,13R)-2,7,10-trihydroxy-11-methyl-12,16-dioxatetracyclo[11.3.1.01,10.03,8]heptadeca-3(8),4,6-triene-9,15-dione (PubChem CID 53483701) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is (1S,2R,10R,11S,13R)-2,7,10-trihydroxy-11-methyl-12,16-dioxatetracyclo[11.3.1.01,10.03,8]heptadeca-3(8),4,6-triene-9,15-dione.
| Compound Name | (1S,2R,10R,11S,13R)-2,7,10-trihydroxy-11-methyl-12,16-dioxatetracyclo[11.3.1.01,10.03,8]heptadeca-3(8),4,6-triene-9,15-dione |
|---|---|
| PubChem CID | 53483701 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (1S,2R,10R,11S,13R)-2,7,10-trihydroxy-11-methyl-12,16-dioxatetracyclo[11.3.1.01,10.03,8]heptadeca-3(8),4,6-triene-9,15-dione |
| SMILES | C[C@@H]1O[C@H]2CC(=O)O[C@@]3(C2)[C@H](O)c2cccc(O)c2C(=O)[C@@]13O |
| InChI | InChI=1S/C16H16O7/c1-7-16(21)14(20)12-9(3-2-4-10(12)17)13(19)15(16)6-8(22-7)5-11(18)23-15/h2-4,7-8,13,17,19,21H,5-6H2,1H3/t7-,8-,13+,15-,16-/m0/s1 |
| InChIKey | QVIOAXJSVAWQGK-NTOSCNRDSA-N |
| XLogP | 0.22 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |