C13H12O5 — CID 162845090
1a-acetyl-3,7-dihydroxy-7a-methyl-7H-naphtho[2,3-b]oxiren-2-one (PubChem CID 162845090) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is 1a-acetyl-3,7-dihydroxy-7a-methyl-7H-naphtho[2,3-b]oxiren-2-one.
| Compound Name | 1a-acetyl-3,7-dihydroxy-7a-methyl-7H-naphtho[2,3-b]oxiren-2-one |
|---|---|
| PubChem CID | 162845090 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1a-acetyl-3,7-dihydroxy-7a-methyl-7H-naphtho[2,3-b]oxiren-2-one |
| SMILES | CC(=O)C12OC1(C)C(O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C13H12O5/c1-6(14)13-11(17)9-7(4-3-5-8(9)15)10(16)12(13,2)18-13/h3-5,10,15-16H,1-2H3 |
| InChIKey | LGWHJCRVCDFIPB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|