C10H10O4 — CID 11275563
(2S,4R)-2,4,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 11275563) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is (2S,4R)-2,4,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | (2S,4R)-2,4,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 11275563 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (2S,4R)-2,4,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2c(O)cccc2[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C10H10O4/c11-6-3-1-2-5-7(12)4-8(13)10(14)9(5)6/h1-3,7-8,11-13H,4H2/t7-,8+/m1/s1 |
| InChIKey | FHAMKLIXDLEUPK-SFYZADRCSA-N |
| XLogP | 0.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |