C11H12O — CID 58714111
(1R)-3-ethenyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 58714111) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (1R)-3-ethenyl-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R)-3-ethenyl-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 58714111 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (1R)-3-ethenyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | C=CC1C[C@@H](O)c2ccccc21 |
| InChI | InChI=1S/C11H12O/c1-2-8-7-11(12)10-6-4-3-5-9(8)10/h2-6,8,11-12H,1,7H2/t8?,11-/m1/s1 |
| InChIKey | ANOSHHJUZGKZKC-QHDYGNBISA-N |
| XLogP | 2.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|