C12H16OS — CID 82888344
(5S)-1,3-dimethyl-1,3,4,5-tetrahydro-2-benzothiepin-5-ol (PubChem CID 82888344) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is (5S)-1,3-dimethyl-1,3,4,5-tetrahydro-2-benzothiepin-5-ol.
| Compound Name | (5S)-1,3-dimethyl-1,3,4,5-tetrahydro-2-benzothiepin-5-ol |
|---|---|
| PubChem CID | 82888344 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (5S)-1,3-dimethyl-1,3,4,5-tetrahydro-2-benzothiepin-5-ol |
| SMILES | CC1C[C@H](O)c2ccccc2C(C)S1 |
| InChI | InChI=1S/C12H16OS/c1-8-7-12(13)11-6-4-3-5-10(11)9(2)14-8/h3-6,8-9,12-13H,7H2,1-2H3/t8?,9?,12-/m0/s1 |
| InChIKey | WBFMIIZHGRFRFO-KWPJZBAWSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |