C9H11NO2 — CID 155578583
1,2,3,4-tetrahydroquinoline-2,4-diol (PubChem CID 155578583) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinoline-2,4-diol.
| Compound Name | 1,2,3,4-tetrahydroquinoline-2,4-diol |
|---|---|
| PubChem CID | 155578583 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1,2,3,4-tetrahydroquinoline-2,4-diol |
| SMILES | OC1CC(O)c2ccccc2N1 |
| InChI | InChI=1S/C9H11NO2/c11-8-5-9(12)10-7-4-2-1-3-6(7)8/h1-4,8-12H,5H2 |
| InChIKey | DNTDDPVQUKQKBJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |