C14H13NO — CID 86312420
(5R)-6,11-dihydro-5H-benzo[b][1]benzazepin-5-ol (PubChem CID 86312420) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is (5R)-6,11-dihydro-5H-benzo[b][1]benzazepin-5-ol.
| Compound Name | (5R)-6,11-dihydro-5H-benzo[b][1]benzazepin-5-ol |
|---|---|
| PubChem CID | 86312420 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (5R)-6,11-dihydro-5H-benzo[b][1]benzazepin-5-ol |
| SMILES | O[C@@H]1Cc2ccccc2Nc2ccccc21 |
| InChI | InChI=1S/C14H13NO/c16-14-9-10-5-1-3-7-12(10)15-13-8-4-2-6-11(13)14/h1-8,14-16H,9H2/t14-/m1/s1 |
| InChIKey | NPKCAMZGRRHFTJ-CQSZACIVSA-N |
| XLogP | 3.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |