About CID 175321967
CID 175321967 (PubChem CID 175321967) has the molecular formula C13H10BN
and a molecular weight of 191.04 g/mol.
Molecular Properties
| Compound Name | CID 175321967 |
| PubChem CID | 175321967 |
| Molecular Formula | C13H10BN |
| Molecular Weight | 191.04 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | — |
| SMILES | [B]C1c2ccccc2Nc2ccccc21 |
| InChI | InChI=1S/C13H10BN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13,15H |
| InChIKey | OYYBVIJPOMWQIT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.04 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175321967 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175321967?
The IUPAC name of CID 175321967 (CID 175321967) is not available.
What is the SMILES notation for CID 175321967?
The canonical SMILES for CID 175321967 is [B]C1c2ccccc2Nc2ccccc21.
What is the InChIKey of CID 175321967?
The InChIKey is OYYBVIJPOMWQIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13,15H.
What are the key properties of CID 175321967?
CID 175321967 has a molecular weight of 191.04 g/mol, XLogP of 3.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175321967 is sourced from PubChem (CID 175321967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).