About disodium;5,10-dihydrophenazine;hydride
disodium;5,10-dihydrophenazine;hydride (PubChem CID 173242868) has the molecular formula C12H12N2Na2
and a molecular weight of 230.22 g/mol. Its IUPAC name is disodium;5,10-dihydrophenazine;hydride.
Molecular Properties
| Compound Name | disodium;5,10-dihydrophenazine;hydride |
| PubChem CID | 173242868 |
| Molecular Formula | C12H12N2Na2 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | disodium;5,10-dihydrophenazine;hydride |
| SMILES | [H-].[H-].[Na+].[Na+].c1ccc2c(c1)Nc1ccccc1N2 |
| InChI | InChI=1S/C12H10N2.2Na.2H/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;;;;/h1-8,13-14H;;;;/q;2*+1;2*-1 |
| InChIKey | CJJQXHFJHKNPCX-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze disodium;5,10-dihydrophenazine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;5,10-dihydrophenazine;hydride?
The IUPAC name of disodium;5,10-dihydrophenazine;hydride (CID 173242868) is disodium;5,10-dihydrophenazine;hydride.
What is the SMILES notation for disodium;5,10-dihydrophenazine;hydride?
The canonical SMILES for disodium;5,10-dihydrophenazine;hydride is [H-].[H-].[Na+].[Na+].c1ccc2c(c1)Nc1ccccc1N2.
What is the InChIKey of disodium;5,10-dihydrophenazine;hydride?
The InChIKey is CJJQXHFJHKNPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2.2Na.2H/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;;;;/h1-8,13-14H;;;;/q;2*+1;2*-1.
What are the key properties of disodium;5,10-dihydrophenazine;hydride?
disodium;5,10-dihydrophenazine;hydride has a molecular weight of 230.22 g/mol, XLogP of -2.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;5,10-dihydrophenazine;hydride is sourced from PubChem (CID 173242868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).