About 1-phenyl-5,10-dihydrophenazine
1-phenyl-5,10-dihydrophenazine (PubChem CID 70539713) has the molecular formula C18H14N2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-phenyl-5,10-dihydrophenazine.
Molecular Properties
| Compound Name | 1-phenyl-5,10-dihydrophenazine |
| PubChem CID | 70539713 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-phenyl-5,10-dihydrophenazine |
| SMILES | c1ccc(-c2cccc3c2Nc2ccccc2N3)cc1 |
| InChI | InChI=1S/C18H14N2/c1-2-7-13(8-3-1)14-9-6-12-17-18(14)20-16-11-5-4-10-15(16)19-17/h1-12,19-20H |
| InChIKey | ZQRANPMEQCFOBX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-5,10-dihydrophenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-5,10-dihydrophenazine?
The IUPAC name of 1-phenyl-5,10-dihydrophenazine (CID 70539713) is 1-phenyl-5,10-dihydrophenazine.
What is the SMILES notation for 1-phenyl-5,10-dihydrophenazine?
The canonical SMILES for 1-phenyl-5,10-dihydrophenazine is c1ccc(-c2cccc3c2Nc2ccccc2N3)cc1.
What is the InChIKey of 1-phenyl-5,10-dihydrophenazine?
The InChIKey is ZQRANPMEQCFOBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2/c1-2-7-13(8-3-1)14-9-6-12-17-18(14)20-16-11-5-4-10-15(16)19-17/h1-12,19-20H.
What are the key properties of 1-phenyl-5,10-dihydrophenazine?
1-phenyl-5,10-dihydrophenazine has a molecular weight of 258.32 g/mol, XLogP of 5.15, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-5,10-dihydrophenazine is sourced from PubChem (CID 70539713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).