C18H14N2 — CID 70539713
1-phenyl-5,10-dihydrophenazine (PubChem CID 70539713) has the molecular formula C18H14N2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-phenyl-5,10-dihydrophenazine.
| Compound Name | 1-phenyl-5,10-dihydrophenazine |
|---|---|
| PubChem CID | 70539713 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-phenyl-5,10-dihydrophenazine |
| SMILES | c1ccc(-c2cccc3c2Nc2ccccc2N3)cc1 |
| InChI | InChI=1S/C18H14N2/c1-2-7-13(8-3-1)14-9-6-12-17-18(14)20-16-11-5-4-10-15(16)19-17/h1-12,19-20H |
| InChIKey | ZQRANPMEQCFOBX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |