C12H9NO2 — CID 141035988
4-phenyl-3H-1,2,3-benzodioxazole (PubChem CID 141035988) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-phenyl-3H-1,2,3-benzodioxazole.
| Compound Name | 4-phenyl-3H-1,2,3-benzodioxazole |
|---|---|
| PubChem CID | 141035988 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 4-phenyl-3H-1,2,3-benzodioxazole |
| SMILES | c1ccc(-c2cccc3c2NOO3)cc1 |
| InChI | InChI=1S/C12H9NO2/c1-2-5-9(6-3-1)10-7-4-8-11-12(10)13-15-14-11/h1-8,13H |
| InChIKey | DGAJZNRLUVMKIV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|