C36H26Pb2 — CID 177444847
(2,6-diphenylphenyl)-(2,6-diphenylphenyl)plumbanylidynelead (PubChem CID 177444847) has the molecular formula C36H26Pb2 and a molecular weight of 873.00 g/mol. Its IUPAC name is (2,6-diphenylphenyl)-(2,6-diphenylphenyl)plumbanylidynelead.
| Compound Name | (2,6-diphenylphenyl)-(2,6-diphenylphenyl)plumbanylidynelead |
|---|---|
| PubChem CID | 177444847 |
| Molecular Formula | C36H26Pb2 |
| Molecular Weight | 873.00 g/mol |
| Exact Mass | 874.16 |
| IUPAC Name | (2,6-diphenylphenyl)-(2,6-diphenylphenyl)plumbanylidynelead |
| SMILES | c1ccc(-c2cccc(-c3ccccc3)c2[Pb]#[Pb]c2c(-c3ccccc3)cccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H13.2Pb/c2*1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;;/h2*1-13H;; |
| InChIKey | YDRDYZLAVFEVTE-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.00 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |