About 1-bromo-5,10-dihydrophenazine
1-bromo-5,10-dihydrophenazine (PubChem CID 155754239) has the molecular formula C12H9BrN2
and a molecular weight of 261.12 g/mol. Its IUPAC name is 1-bromo-5,10-dihydrophenazine.
Molecular Properties
| Compound Name | 1-bromo-5,10-dihydrophenazine |
| PubChem CID | 155754239 |
| Molecular Formula | C12H9BrN2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 1-bromo-5,10-dihydrophenazine |
| SMILES | Brc1cccc2c1Nc1ccccc1N2 |
| InChI | InChI=1S/C12H9BrN2/c13-8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7,14-15H |
| InChIKey | VZDDVSPOHKCFHN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-5,10-dihydrophenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5,10-dihydrophenazine?
The IUPAC name of 1-bromo-5,10-dihydrophenazine (CID 155754239) is 1-bromo-5,10-dihydrophenazine.
What is the SMILES notation for 1-bromo-5,10-dihydrophenazine?
The canonical SMILES for 1-bromo-5,10-dihydrophenazine is Brc1cccc2c1Nc1ccccc1N2.
What is the InChIKey of 1-bromo-5,10-dihydrophenazine?
The InChIKey is VZDDVSPOHKCFHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN2/c13-8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7,14-15H.
What are the key properties of 1-bromo-5,10-dihydrophenazine?
1-bromo-5,10-dihydrophenazine has a molecular weight of 261.12 g/mol, XLogP of 4.25, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5,10-dihydrophenazine is sourced from PubChem (CID 155754239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).