C12H9BrN2 — CID 155754239
1-bromo-5,10-dihydrophenazine (PubChem CID 155754239) has the molecular formula C12H9BrN2 and a molecular weight of 261.12 g/mol. Its IUPAC name is 1-bromo-5,10-dihydrophenazine.
| Compound Name | 1-bromo-5,10-dihydrophenazine |
|---|---|
| PubChem CID | 155754239 |
| Molecular Formula | C12H9BrN2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 1-bromo-5,10-dihydrophenazine |
| SMILES | Brc1cccc2c1Nc1ccccc1N2 |
| InChI | InChI=1S/C12H9BrN2/c13-8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7,14-15H |
| InChIKey | VZDDVSPOHKCFHN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |