C18H22N2 — CID 141276378
1-hexyl-5,10-dihydrophenazine (PubChem CID 141276378) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-hexyl-5,10-dihydrophenazine.
| Compound Name | 1-hexyl-5,10-dihydrophenazine |
|---|---|
| PubChem CID | 141276378 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-hexyl-5,10-dihydrophenazine |
| SMILES | CCCCCCc1cccc2c1Nc1ccccc1N2 |
| InChI | InChI=1S/C18H22N2/c1-2-3-4-5-9-14-10-8-13-17-18(14)20-16-12-7-6-11-15(16)19-17/h6-8,10-13,19-20H,2-5,9H2,1H3 |
| InChIKey | VVUFSOCSYAOZNF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|