C9H9NOS — CID 130016382
3-hydroxy-3,4-dihydro-1H-quinoline-2-thione (PubChem CID 130016382) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 3-hydroxy-3,4-dihydro-1H-quinoline-2-thione.
| Compound Name | 3-hydroxy-3,4-dihydro-1H-quinoline-2-thione |
|---|---|
| PubChem CID | 130016382 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 3-hydroxy-3,4-dihydro-1H-quinoline-2-thione |
| SMILES | OC1Cc2ccccc2NC1=S |
| InChI | InChI=1S/C9H9NOS/c11-8-5-6-3-1-2-4-7(6)10-9(8)12/h1-4,8,11H,5H2,(H,10,12) |
| InChIKey | ZINLIOLOJWAXJF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|