About (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol
(2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol (PubChem CID 10397277) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol.
Analyze (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol?
The IUPAC name of (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol (CID 10397277) is (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol.
What is the SMILES notation for (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol?
The canonical SMILES for (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol is O[C@H]1CC[C@@H]2C[C@@H]2c2ccccc21.
What is the InChIKey of (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol?
The InChIKey is LXGHBMJBCFQXLP-ZHAHWJHGSA-N. The full InChI is InChI=1S/C12H14O/c13-12-6-5-8-7-11(8)9-3-1-2-4-10(9)12/h1-4,8,11-13H,5-7H2/t8-,11+,12+/m1/s1.
What are the key properties of (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol?
(2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol has a molecular weight of 174.24 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R,7S)-tricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-7-ol is sourced from PubChem (CID 10397277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).