C14H16O — CID 144746832
(E)-3-[(3R)-3-ethenyl-2,3-dihydro-1H-inden-1-yl]prop-2-en-1-ol (PubChem CID 144746832) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is (E)-3-[(3R)-3-ethenyl-2,3-dihydro-1H-inden-1-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(3R)-3-ethenyl-2,3-dihydro-1H-inden-1-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 144746832 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (E)-3-[(3R)-3-ethenyl-2,3-dihydro-1H-inden-1-yl]prop-2-en-1-ol |
| SMILES | C=C[C@H]1CC(/C=C/CO)c2ccccc21 |
| InChI | InChI=1S/C14H16O/c1-2-11-10-12(6-5-9-15)14-8-4-3-7-13(11)14/h2-8,11-12,15H,1,9-10H2/b6-5+/t11-,12?/m0/s1 |
| InChIKey | GOODBGZELGIGCH-VSDTWRRPSA-N |
| XLogP | 2.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|