C16H20 — CID 160724552
7-ethenylbicyclo[4.2.0]octa-1,3,5-triene;hexa-1,4-diene (PubChem CID 160724552) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 7-ethenylbicyclo[4.2.0]octa-1,3,5-triene;hexa-1,4-diene.
| Compound Name | 7-ethenylbicyclo[4.2.0]octa-1,3,5-triene;hexa-1,4-diene |
|---|---|
| PubChem CID | 160724552 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 7-ethenylbicyclo[4.2.0]octa-1,3,5-triene;hexa-1,4-diene |
| SMILES | C=CC1Cc2ccccc21.C=CCC=CC |
| InChI | InChI=1S/C10H10.C6H10/c1-2-8-7-9-5-3-4-6-10(8)9;1-3-5-6-4-2/h2-6,8H,1,7H2;3-4,6H,1,5H2,2H3 |
| InChIKey | RTNOWYIWKYKXDB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|