About 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene
2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene (PubChem CID 142896770) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene.
Molecular Properties
| Compound Name | 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene |
| PubChem CID | 142896770 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene |
| SMILES | C/C=C\CC.C=C1Cc2ccccc2O1 |
| InChI | InChI=1S/C9H8O.C5H10/c1-7-6-8-4-2-3-5-9(8)10-7;1-3-5-4-2/h2-5H,1,6H2;3,5H,4H2,1-2H3/b;5-3- |
| InChIKey | AOEFEVBHXZMJIW-PJAIOPLOSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene?
The IUPAC name of 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene (CID 142896770) is 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene.
What is the SMILES notation for 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene?
The canonical SMILES for 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene is C/C=C\CC.C=C1Cc2ccccc2O1.
What is the InChIKey of 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene?
The InChIKey is AOEFEVBHXZMJIW-PJAIOPLOSA-N. The full InChI is InChI=1S/C9H8O.C5H10/c1-7-6-8-4-2-3-5-9(8)10-7;1-3-5-4-2/h2-5H,1,6H2;3,5H,4H2,1-2H3/b;5-3-.
What are the key properties of 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene?
2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene has a molecular weight of 202.30 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-3H-1-benzofuran;(Z)-pent-2-ene is sourced from PubChem (CID 142896770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).