C18H24 — CID 143620330
1,1-dimethyl-2,3-dimethylideneindene;(E)-pent-2-ene (PubChem CID 143620330) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1,1-dimethyl-2,3-dimethylideneindene;(E)-pent-2-ene.
| Compound Name | 1,1-dimethyl-2,3-dimethylideneindene;(E)-pent-2-ene |
|---|---|
| PubChem CID | 143620330 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 1,1-dimethyl-2,3-dimethylideneindene;(E)-pent-2-ene |
| SMILES | C/C=C/CC.C=C1C(=C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C13H14.C5H10/c1-9-10(2)13(3,4)12-8-6-5-7-11(9)12;1-3-5-4-2/h5-8H,1-2H2,3-4H3;3,5H,4H2,1-2H3/b;5-3+ |
| InChIKey | YFGKIYQUUMDKIT-GWDXERMASA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|