C29H46 — CID 162270307
9,9-bis(but-1-enyl)fluorene;methane;propane (PubChem CID 162270307) has the molecular formula C29H46 and a molecular weight of 394.69 g/mol. Its IUPAC name is 9,9-bis(but-1-enyl)fluorene;methane;propane.
| Compound Name | 9,9-bis(but-1-enyl)fluorene;methane;propane |
|---|---|
| PubChem CID | 162270307 |
| Molecular Formula | C29H46 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | 9,9-bis(but-1-enyl)fluorene;methane;propane |
| SMILES | C.C.CCC.CCC.CCC=CC1(C=CCC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H22.2C3H8.2CH4/c1-3-5-15-21(16-6-4-2)19-13-9-7-11-17(19)18-12-8-10-14-20(18)21;2*1-3-2;;/h5-16H,3-4H2,1-2H3;2*3H2,1-2H3;2*1H4 |
| InChIKey | DMGGHWNCZYPKEY-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|