About methane;9-methylfluoren-9-ol
methane;9-methylfluoren-9-ol (PubChem CID 160708378) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is methane;9-methylfluoren-9-ol.
Molecular Properties
| Compound Name | methane;9-methylfluoren-9-ol |
| PubChem CID | 160708378 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | methane;9-methylfluoren-9-ol |
| SMILES | C.CC1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H12O.CH4/c1-14(15)12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;/h2-9,15H,1H3;1H4 |
| InChIKey | RRNISARZLMWTOK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;9-methylfluoren-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;9-methylfluoren-9-ol?
The IUPAC name of methane;9-methylfluoren-9-ol (CID 160708378) is methane;9-methylfluoren-9-ol.
What is the SMILES notation for methane;9-methylfluoren-9-ol?
The canonical SMILES for methane;9-methylfluoren-9-ol is C.CC1(O)c2ccccc2-c2ccccc21.
What is the InChIKey of methane;9-methylfluoren-9-ol?
The InChIKey is RRNISARZLMWTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O.CH4/c1-14(15)12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;/h2-9,15H,1H3;1H4.
What are the key properties of methane;9-methylfluoren-9-ol?
methane;9-methylfluoren-9-ol has a molecular weight of 212.29 g/mol, XLogP of 3.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;9-methylfluoren-9-ol is sourced from PubChem (CID 160708378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).