About carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol
carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol (PubChem CID 10959383) has the molecular formula C18H14CrO5
and a molecular weight of 362.30 g/mol. Its IUPAC name is carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol.
Molecular Properties
| Compound Name | carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol |
| PubChem CID | 10959383 |
| Molecular Formula | C18H14CrO5 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol |
| SMILES | C[C@]1(O)c2ccccc2-c2ccccc2[C@@H]1O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C15H14O2.3CO.Cr/c1-15(17)13-9-5-4-7-11(13)10-6-2-3-8-12(10)14(15)16;3*1-2;/h2-9,14,16-17H,1H3;;;;/t14-,15-;;;;/m0..../s1 |
| InChIKey | ONTKZYFNJYQMAE-JJSNJLKGSA-N |
| XLogP | 2.49 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol?
The IUPAC name of carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol (CID 10959383) is carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol.
What is the SMILES notation for carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol?
The canonical SMILES for carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol is C[C@]1(O)c2ccccc2-c2ccccc2[C@@H]1O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol?
The InChIKey is ONTKZYFNJYQMAE-JJSNJLKGSA-N. The full InChI is InChI=1S/C15H14O2.3CO.Cr/c1-15(17)13-9-5-4-7-11(13)10-6-2-3-8-12(10)14(15)16;3*1-2;/h2-9,14,16-17H,1H3;;;;/t14-,15-;;;;/m0..../s1.
What are the key properties of carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol?
carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol has a molecular weight of 362.30 g/mol, XLogP of 2.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol is sourced from PubChem (CID 10959383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).