C18H14CrO5 — CID 10959383
carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol (PubChem CID 10959383) has the molecular formula C18H14CrO5 and a molecular weight of 362.30 g/mol. Its IUPAC name is carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol.
| Compound Name | carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol |
|---|---|
| PubChem CID | 10959383 |
| Molecular Formula | C18H14CrO5 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | carbon monoxide;chromium;(9S,10S)-10-methyl-9H-phenanthrene-9,10-diol |
| SMILES | C[C@]1(O)c2ccccc2-c2ccccc2[C@@H]1O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C15H14O2.3CO.Cr/c1-15(17)13-9-5-4-7-11(13)10-6-2-3-8-12(10)14(15)16;3*1-2;/h2-9,14,16-17H,1H3;;;;/t14-,15-;;;;/m0..../s1 |
| InChIKey | ONTKZYFNJYQMAE-JJSNJLKGSA-N |
| XLogP | 2.49 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|