C15H20O2 — CID 12034952
(1S,2R)-1,4-dimethyl-3-propan-2-yl-2H-naphthalene-1,2-diol (PubChem CID 12034952) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1S,2R)-1,4-dimethyl-3-propan-2-yl-2H-naphthalene-1,2-diol.
| Compound Name | (1S,2R)-1,4-dimethyl-3-propan-2-yl-2H-naphthalene-1,2-diol |
|---|---|
| PubChem CID | 12034952 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1S,2R)-1,4-dimethyl-3-propan-2-yl-2H-naphthalene-1,2-diol |
| SMILES | CC1=C(C(C)C)[C@@H](O)[C@@](C)(O)c2ccccc21 |
| InChI | InChI=1S/C15H20O2/c1-9(2)13-10(3)11-7-5-6-8-12(11)15(4,17)14(13)16/h5-9,14,16-17H,1-4H3/t14-,15+/m1/s1 |
| InChIKey | BTBNLOTVAYRLDZ-CABCVRRESA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |