C17H16Cl2O — CID 23265010
9-(dichloromethyl)-10,10-dimethylphenanthren-9-ol (PubChem CID 23265010) has the molecular formula C17H16Cl2O and a molecular weight of 307.22 g/mol. Its IUPAC name is 9-(dichloromethyl)-10,10-dimethylphenanthren-9-ol.
| Compound Name | 9-(dichloromethyl)-10,10-dimethylphenanthren-9-ol |
|---|---|
| PubChem CID | 23265010 |
| Molecular Formula | C17H16Cl2O |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 9-(dichloromethyl)-10,10-dimethylphenanthren-9-ol |
| SMILES | CC1(C)c2ccccc2-c2ccccc2C1(O)C(Cl)Cl |
| InChI | InChI=1S/C17H16Cl2O/c1-16(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)17(16,20)15(18)19/h3-10,15,20H,1-2H3 |
| InChIKey | HZABQTIEYWWCTO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|