C14H18Cl2O — CID 71425229
2-(dichloromethyl)-1,1,3,3-tetramethylinden-2-ol (PubChem CID 71425229) has the molecular formula C14H18Cl2O and a molecular weight of 273.20 g/mol. Its IUPAC name is 2-(dichloromethyl)-1,1,3,3-tetramethylinden-2-ol.
| Compound Name | 2-(dichloromethyl)-1,1,3,3-tetramethylinden-2-ol |
|---|---|
| PubChem CID | 71425229 |
| Molecular Formula | C14H18Cl2O |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(dichloromethyl)-1,1,3,3-tetramethylinden-2-ol |
| SMILES | CC1(C)c2ccccc2C(C)(C)C1(O)C(Cl)Cl |
| InChI | InChI=1S/C14H18Cl2O/c1-12(2)9-7-5-6-8-10(9)13(3,4)14(12,17)11(15)16/h5-8,11,17H,1-4H3 |
| InChIKey | ZMVFQYOTQUPPSA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|