C15H18O2 — CID 101090906
(1S,2S)-1,2-bis(ethenyl)-3,3-dimethylindene-1,2-diol (PubChem CID 101090906) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (1S,2S)-1,2-bis(ethenyl)-3,3-dimethylindene-1,2-diol.
| Compound Name | (1S,2S)-1,2-bis(ethenyl)-3,3-dimethylindene-1,2-diol |
|---|---|
| PubChem CID | 101090906 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (1S,2S)-1,2-bis(ethenyl)-3,3-dimethylindene-1,2-diol |
| SMILES | C=C[C@]1(O)c2ccccc2C(C)(C)[C@@]1(O)C=C |
| InChI | InChI=1S/C15H18O2/c1-5-14(16)12-10-8-7-9-11(12)13(3,4)15(14,17)6-2/h5-10,16-17H,1-2H2,3-4H3/t14-,15-/m0/s1 |
| InChIKey | RSQGUANJYNVEJB-GJZGRUSLSA-N |
| XLogP | 2.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|