C13H16O2 — CID 101130359
(1aR,2R,7bR)-2,3,3-trimethyl-1a,7b-dihydronaphtho[1,2-b]oxiren-2-ol (PubChem CID 101130359) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (1aR,2R,7bR)-2,3,3-trimethyl-1a,7b-dihydronaphtho[1,2-b]oxiren-2-ol.
| Compound Name | (1aR,2R,7bR)-2,3,3-trimethyl-1a,7b-dihydronaphtho[1,2-b]oxiren-2-ol |
|---|---|
| PubChem CID | 101130359 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (1aR,2R,7bR)-2,3,3-trimethyl-1a,7b-dihydronaphtho[1,2-b]oxiren-2-ol |
| SMILES | CC1(C)c2ccccc2[C@H]2O[C@H]2[C@]1(C)O |
| InChI | InChI=1S/C13H16O2/c1-12(2)9-7-5-4-6-8(9)10-11(15-10)13(12,3)14/h4-7,10-11,14H,1-3H3/t10-,11-,13+/m1/s1 |
| InChIKey | PLZQENGKDBXLTR-WZRBSPASSA-N |
| XLogP | 2.17 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|