C14H18O3 — CID 58601338
2-(dimethoxymethyl)-2-methyl-3,7b-dihydro-1aH-naphtho[1,2-b]oxirene (PubChem CID 58601338) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-2-methyl-3,7b-dihydro-1aH-naphtho[1,2-b]oxirene.
| Compound Name | 2-(dimethoxymethyl)-2-methyl-3,7b-dihydro-1aH-naphtho[1,2-b]oxirene |
|---|---|
| PubChem CID | 58601338 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-(dimethoxymethyl)-2-methyl-3,7b-dihydro-1aH-naphtho[1,2-b]oxirene |
| SMILES | COC(OC)C1(C)Cc2ccccc2C2OC21 |
| InChI | InChI=1S/C14H18O3/c1-14(13(15-2)16-3)8-9-6-4-5-7-10(9)11-12(14)17-11/h4-7,11-13H,8H2,1-3H3 |
| InChIKey | WBAGKOICYRXCTB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|